C18H15N3O3 — CID 14182561
N-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-3-pyridinyl]formamide (PubChem CID 14182561) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-3-pyridinyl]formamide.
| Compound Name | N-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-3-pyridinyl]formamide |
|---|---|
| PubChem CID | 14182561 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-3-pyridinyl]formamide |
| SMILES | CC1(C)C=C(n2cccc(NC=O)c2=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C18H15N3O3/c1-18(2)9-15(13-8-12(10-19)5-6-16(13)24-18)21-7-3-4-14(17(21)23)20-11-22/h3-9,11H,1-2H3,(H,20,22) |
| InChIKey | TZRBMUBAEJBZFH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|