C20H20N2O5S — CID 19092598
2-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]ethyl methanesulfonate (PubChem CID 19092598) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]ethyl methanesulfonate.
| Compound Name | 2-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 19092598 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]ethyl methanesulfonate |
| SMILES | CC1(C)C=C(n2ccc(CCOS(C)(=O)=O)cc2=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C20H20N2O5S/c1-20(2)12-17(16-10-15(13-21)4-5-18(16)27-20)22-8-6-14(11-19(22)23)7-9-26-28(3,24)25/h4-6,8,10-12H,7,9H2,1-3H3 |
| InChIKey | JIJDCUQFTUAIDU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|