C22H24N2O8S2 — CID 19092586
[3-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]-3-methylsulfonyloxypropyl] methanesulfonate (PubChem CID 19092586) has the molecular formula C22H24N2O8S2 and a molecular weight of 508.57 g/mol. Its IUPAC name is [3-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]-3-methylsulfonyloxypropyl] methanesulfonate.
| Compound Name | [3-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]-3-methylsulfonyloxypropyl] methanesulfonate |
|---|---|
| PubChem CID | 19092586 |
| Molecular Formula | C22H24N2O8S2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | [3-[1-(6-cyano-2,2-dimethylchromen-4-yl)-2-oxo-4-pyridinyl]-3-methylsulfonyloxypropyl] methanesulfonate |
| SMILES | CC1(C)C=C(n2ccc(C(CCOS(C)(=O)=O)OS(C)(=O)=O)cc2=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C22H24N2O8S2/c1-22(2)13-18(17-11-15(14-23)5-6-20(17)31-22)24-9-7-16(12-21(24)25)19(32-34(4,28)29)8-10-30-33(3,26)27/h5-7,9,11-13,19H,8,10H2,1-4H3 |
| InChIKey | AHKMGTKDSUDRNZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 141.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|