C18H15BrN2O2 — CID 139649527
4-[5-(bromomethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile (PubChem CID 139649527) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is 4-[5-(bromomethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile.
| Compound Name | 4-[5-(bromomethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile |
|---|---|
| PubChem CID | 139649527 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 4-[5-(bromomethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile |
| SMILES | CC1(C)C=C(n2cc(CBr)ccc2=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C18H15BrN2O2/c1-18(2)8-15(21-11-13(9-19)4-6-17(21)22)14-7-12(10-20)3-5-16(14)23-18/h3-8,11H,9H2,1-2H3 |
| InChIKey | UZENORWKOKQMSN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|