C22H26N2O3Si — CID 19092583
4-[4-(1-hydroxy-2-trimethylsilylethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile (PubChem CID 19092583) has the molecular formula C22H26N2O3Si and a molecular weight of 394.55 g/mol. Its IUPAC name is 4-[4-(1-hydroxy-2-trimethylsilylethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile.
| Compound Name | 4-[4-(1-hydroxy-2-trimethylsilylethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile |
|---|---|
| PubChem CID | 19092583 |
| Molecular Formula | C22H26N2O3Si |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[4-(1-hydroxy-2-trimethylsilylethyl)-2-oxo-1-pyridinyl]-2,2-dimethylchromene-6-carbonitrile |
| SMILES | CC1(C)C=C(n2ccc(C(O)C[Si](C)(C)C)cc2=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C22H26N2O3Si/c1-22(2)12-18(17-10-15(13-23)6-7-20(17)27-22)24-9-8-16(11-21(24)26)19(25)14-28(3,4)5/h6-12,19,25H,14H2,1-5H3 |
| InChIKey | LAUKHWHZSZDSQM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|