C16H18N2O3S — CID 14511116
4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile (PubChem CID 14511116) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile.
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile |
|---|---|
| PubChem CID | 14511116 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile |
| SMILES | CC1(C)C=C(N2CCCCS2(=O)=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C16H18N2O3S/c1-16(2)10-14(18-7-3-4-8-22(18,19)20)13-9-12(11-17)5-6-15(13)21-16/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | CVHLVPNJLRTBBB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |