About 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile
4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile (PubChem CID 14511116) has the molecular formula C16H18N2O3S
and a molecular weight of 318.40 g/mol. Its IUPAC name is 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile |
| PubChem CID | 14511116 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile |
| SMILES | CC1(C)C=C(N2CCCCS2(=O)=O)c2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C16H18N2O3S/c1-16(2)10-14(18-7-3-4-8-22(18,19)20)13-9-12(11-17)5-6-15(13)21-16/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | CVHLVPNJLRTBBB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile?
The IUPAC name of 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile (CID 14511116) is 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile.
What is the SMILES notation for 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile?
The canonical SMILES for 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile is CC1(C)C=C(N2CCCCS2(=O)=O)c2cc(C#N)ccc2O1.
What is the InChIKey of 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile?
The InChIKey is CVHLVPNJLRTBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3S/c1-16(2)10-14(18-7-3-4-8-22(18,19)20)13-9-12(11-17)5-6-15(13)21-16/h5-6,9-10H,3-4,7-8H2,1-2H3.
What are the key properties of 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile?
4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile has a molecular weight of 318.40 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiazinan-2-yl)-2,2-dimethylchromene-6-carbonitrile is sourced from PubChem (CID 14511116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).