C17H18F3NO4S — CID 19905356
1-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]piperidin-2-one (PubChem CID 19905356) has the molecular formula C17H18F3NO4S and a molecular weight of 389.40 g/mol. Its IUPAC name is 1-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]piperidin-2-one.
| Compound Name | 1-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]piperidin-2-one |
|---|---|
| PubChem CID | 19905356 |
| Molecular Formula | C17H18F3NO4S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 1-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]piperidin-2-one |
| SMILES | CC1(C)C=C(N2CCCCC2=O)c2cc(S(=O)(=O)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C17H18F3NO4S/c1-16(2)10-13(21-8-4-3-5-15(21)22)12-9-11(6-7-14(12)25-16)26(23,24)17(18,19)20/h6-7,9-10H,3-5,8H2,1-2H3 |
| InChIKey | HADIFBMCBPZANU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |