C24H34N2O10S — CID 174345113
(2S)-2-[(4-methoxycarbonylphenyl)carbamoyl-[4-methyl-6-oxo-5-(sulfomethyl)heptanoyl]amino]-4-methylpentanoic acid (PubChem CID 174345113) has the molecular formula C24H34N2O10S and a molecular weight of 542.61 g/mol. Its IUPAC name is (2S)-2-[(4-methoxycarbonylphenyl)carbamoyl-[4-methyl-6-oxo-5-(sulfomethyl)heptanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(4-methoxycarbonylphenyl)carbamoyl-[4-methyl-6-oxo-5-(sulfomethyl)heptanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 174345113 |
| Molecular Formula | C24H34N2O10S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | (2S)-2-[(4-methoxycarbonylphenyl)carbamoyl-[4-methyl-6-oxo-5-(sulfomethyl)heptanoyl]amino]-4-methylpentanoic acid |
| SMILES | COC(=O)c1ccc(NC(=O)N(C(=O)CCC(C)C(CS(=O)(=O)O)C(C)=O)[C@@H](CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C24H34N2O10S/c1-14(2)12-20(22(29)30)26(24(32)25-18-9-7-17(8-10-18)23(31)36-5)21(28)11-6-15(3)19(16(4)27)13-37(33,34)35/h7-10,14-15,19-20H,6,11-13H2,1-5H3,(H,25,32)(H,29,30)(H,33,34,35)/t15?,19?,20-/m0/s1 |
| InChIKey | NPCPZMITKFFLPH-OAAAQFAESA-N |
| XLogP | 2.84 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|