C30H22F8 — CID 174346029
1,2,4,5-tetrafluoro-3-methyl-6-[(1Z)-1-[(3Z)-2-[1-(4-methylphenyl)ethylidene]-3-[1-(2,3,5,6-tetrafluoro-4-methylphenyl)ethylidene]cyclopropylidene]ethyl]benzene (PubChem CID 174346029) has the molecular formula C30H22F8 and a molecular weight of 534.49 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methyl-6-[(1Z)-1-[(3Z)-2-[1-(4-methylphenyl)ethylidene]-3-[1-(2,3,5,6-tetrafluoro-4-methylphenyl)ethylidene]cyclopropylidene]ethyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methyl-6-[(1Z)-1-[(3Z)-2-[1-(4-methylphenyl)ethylidene]-3-[1-(2,3,5,6-tetrafluoro-4-methylphenyl)ethylidene]cyclopropylidene]ethyl]benzene |
|---|---|
| PubChem CID | 174346029 |
| Molecular Formula | C30H22F8 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methyl-6-[(1Z)-1-[(3Z)-2-[1-(4-methylphenyl)ethylidene]-3-[1-(2,3,5,6-tetrafluoro-4-methylphenyl)ethylidene]cyclopropylidene]ethyl]benzene |
| SMILES | C/C(=C1C(=C(\C)c2c(F)c(F)c(C)c(F)c2F)C/1=C(\C)c1c(F)c(F)c(C)c(F)c1F)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H22F8/c1-11-7-9-17(10-8-11)12(2)18-19(13(3)21-27(35)23(31)15(5)24(32)28(21)36)20(18)14(4)22-29(37)25(33)16(6)26(34)30(22)38/h7-10H,1-6H3/b18-12-,19-13+,20-14- |
| InChIKey | GCMUPXITJAGDJG-RGWVVGSDSA-N |
| XLogP | 9.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|