C21H30N2O — CID 174346951
5-cyclopropyl-7-methyl-4-[(4-propoxypiperidin-1-yl)methyl]-1H-indole (PubChem CID 174346951) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 5-cyclopropyl-7-methyl-4-[(4-propoxypiperidin-1-yl)methyl]-1H-indole.
| Compound Name | 5-cyclopropyl-7-methyl-4-[(4-propoxypiperidin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 174346951 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 5-cyclopropyl-7-methyl-4-[(4-propoxypiperidin-1-yl)methyl]-1H-indole |
| SMILES | CCCOC1CCN(Cc2c(C3CC3)cc(C)c3[nH]ccc23)CC1 |
| InChI | InChI=1S/C21H30N2O/c1-3-12-24-17-7-10-23(11-8-17)14-20-18-6-9-22-21(18)15(2)13-19(20)16-4-5-16/h6,9,13,16-17,22H,3-5,7-8,10-12,14H2,1-2H3 |
| InChIKey | JTTNGJQIAGFWJK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |