C40H39Zr- — CID 174349240
3-cyclopenta-1,3-dien-1-yl-2-(2,7-ditert-butyl-9H-fluoren-1-yl)-4-methyl-1,9-dihydrofluoren-1-ide;zirconium (PubChem CID 174349240) has the molecular formula C40H39Zr- and a molecular weight of 610.98 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-yl-2-(2,7-ditert-butyl-9H-fluoren-1-yl)-4-methyl-1,9-dihydrofluoren-1-ide;zirconium.
| Compound Name | 3-cyclopenta-1,3-dien-1-yl-2-(2,7-ditert-butyl-9H-fluoren-1-yl)-4-methyl-1,9-dihydrofluoren-1-ide;zirconium |
|---|---|
| PubChem CID | 174349240 |
| Molecular Formula | C40H39Zr- |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-yl-2-(2,7-ditert-butyl-9H-fluoren-1-yl)-4-methyl-1,9-dihydrofluoren-1-ide;zirconium |
| SMILES | Cc1c(C2=CC=CC2)c(-c2c(C(C)(C)C)ccc3c2Cc2cc(C(C)(C)C)ccc2-3)[c-]c2c1-c1ccccc1C2.[Zr] |
| InChI | InChI=1S/C40H39.Zr/c1-24-36(25-12-8-9-13-25)34(23-28-20-26-14-10-11-15-31(26)37(24)28)38-33-22-27-21-29(39(2,3)4)16-17-30(27)32(33)18-19-35(38)40(5,6)7;/h8-12,14-19,21H,13,20,22H2,1-7H3;/q-1; |
| InChIKey | CEVZGMBTEGOYRC-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|