C30H37P — CID 155666034
[2-(4,7-ditert-butyl-9H-fluoren-1-yl)phenyl]methyl-dimethylphosphane (PubChem CID 155666034) has the molecular formula C30H37P and a molecular weight of 428.60 g/mol. Its IUPAC name is [2-(4,7-ditert-butyl-9H-fluoren-1-yl)phenyl]methyl-dimethylphosphane.
| Compound Name | [2-(4,7-ditert-butyl-9H-fluoren-1-yl)phenyl]methyl-dimethylphosphane |
|---|---|
| PubChem CID | 155666034 |
| Molecular Formula | C30H37P |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [2-(4,7-ditert-butyl-9H-fluoren-1-yl)phenyl]methyl-dimethylphosphane |
| SMILES | CP(C)Cc1ccccc1-c1ccc(C(C)(C)C)c2c1Cc1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C30H37P/c1-29(2,3)22-13-14-24-21(17-22)18-26-25(15-16-27(28(24)26)30(4,5)6)23-12-10-9-11-20(23)19-31(7)8/h9-17H,18-19H2,1-8H3 |
| InChIKey | XSZSRILTZLKRRX-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|