C28H40O2Si — CID 139803084
cyclopentyl-(2,7-ditert-butyl-9H-fluoren-1-yl)-dimethoxysilane (PubChem CID 139803084) has the molecular formula C28H40O2Si and a molecular weight of 436.71 g/mol. Its IUPAC name is cyclopentyl-(2,7-ditert-butyl-9H-fluoren-1-yl)-dimethoxysilane.
| Compound Name | cyclopentyl-(2,7-ditert-butyl-9H-fluoren-1-yl)-dimethoxysilane |
|---|---|
| PubChem CID | 139803084 |
| Molecular Formula | C28H40O2Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | cyclopentyl-(2,7-ditert-butyl-9H-fluoren-1-yl)-dimethoxysilane |
| SMILES | CO[Si](OC)(c1c(C(C)(C)C)ccc2c1Cc1cc(C(C)(C)C)ccc1-2)C1CCCC1 |
| InChI | InChI=1S/C28H40O2Si/c1-27(2,3)20-13-14-22-19(17-20)18-24-23(22)15-16-25(28(4,5)6)26(24)31(29-7,30-8)21-11-9-10-12-21/h13-17,21H,9-12,18H2,1-8H3 |
| InChIKey | PJMCGIHGCFTVOU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|