C29H34 — CID 172756079
2-tert-butyl-1-cyclopenta-2,4-dien-1-yl-7-(2,4-dimethylpent-3-en-2-yl)-9H-fluorene (PubChem CID 172756079) has the molecular formula C29H34 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2-tert-butyl-1-cyclopenta-2,4-dien-1-yl-7-(2,4-dimethylpent-3-en-2-yl)-9H-fluorene.
| Compound Name | 2-tert-butyl-1-cyclopenta-2,4-dien-1-yl-7-(2,4-dimethylpent-3-en-2-yl)-9H-fluorene |
|---|---|
| PubChem CID | 172756079 |
| Molecular Formula | C29H34 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 2-tert-butyl-1-cyclopenta-2,4-dien-1-yl-7-(2,4-dimethylpent-3-en-2-yl)-9H-fluorene |
| SMILES | CC(C)=CC(C)(C)c1ccc2c(c1)Cc1c-2ccc(C(C)(C)C)c1C1C=CC=C1 |
| InChI | InChI=1S/C29H34/c1-19(2)18-29(6,7)22-12-13-23-21(16-22)17-25-24(23)14-15-26(28(3,4)5)27(25)20-10-8-9-11-20/h8-16,18,20H,17H2,1-7H3 |
| InChIKey | LARQWUJIJVCEAD-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|