C43H48 — CID 141456795
3,6-ditert-butyl-1-[cyclopenta-2,4-dien-1-yl-bis(4-methylphenyl)methyl]-2,7-dimethyl-9H-fluorene (PubChem CID 141456795) has the molecular formula C43H48 and a molecular weight of 564.86 g/mol. Its IUPAC name is 3,6-ditert-butyl-1-[cyclopenta-2,4-dien-1-yl-bis(4-methylphenyl)methyl]-2,7-dimethyl-9H-fluorene.
| Compound Name | 3,6-ditert-butyl-1-[cyclopenta-2,4-dien-1-yl-bis(4-methylphenyl)methyl]-2,7-dimethyl-9H-fluorene |
|---|---|
| PubChem CID | 141456795 |
| Molecular Formula | C43H48 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.38 |
| IUPAC Name | 3,6-ditert-butyl-1-[cyclopenta-2,4-dien-1-yl-bis(4-methylphenyl)methyl]-2,7-dimethyl-9H-fluorene |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)(c2c(C)c(C(C)(C)C)cc3c2Cc2cc(C)c(C(C)(C)C)cc2-3)C2C=CC=C2)cc1 |
| InChI | InChI=1S/C43H48/c1-27-15-19-33(20-16-27)43(32-13-11-12-14-32,34-21-17-28(2)18-22-34)40-30(4)39(42(8,9)10)26-36-35-25-38(41(5,6)7)29(3)23-31(35)24-37(36)40/h11-23,25-26,32H,24H2,1-10H3 |
| InChIKey | OXQNTORQHAXYLS-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|