C41H44 — CID 86606714
2,7-ditert-butyl-1-[cyclopenta-1,3-dien-1-yl-bis(4-methylphenyl)methyl]-9H-fluorene (PubChem CID 86606714) has the molecular formula C41H44 and a molecular weight of 536.80 g/mol. Its IUPAC name is 2,7-ditert-butyl-1-[cyclopenta-1,3-dien-1-yl-bis(4-methylphenyl)methyl]-9H-fluorene.
| Compound Name | 2,7-ditert-butyl-1-[cyclopenta-1,3-dien-1-yl-bis(4-methylphenyl)methyl]-9H-fluorene |
|---|---|
| PubChem CID | 86606714 |
| Molecular Formula | C41H44 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 2,7-ditert-butyl-1-[cyclopenta-1,3-dien-1-yl-bis(4-methylphenyl)methyl]-9H-fluorene |
| SMILES | Cc1ccc(C(C2=CC=CC2)(c2ccc(C)cc2)c2c(C(C)(C)C)ccc3c2Cc2cc(C(C)(C)C)ccc2-3)cc1 |
| InChI | InChI=1S/C41H44/c1-27-13-17-31(18-14-27)41(30-11-9-10-12-30,32-19-15-28(2)16-20-32)38-36-26-29-25-33(39(3,4)5)21-22-34(29)35(36)23-24-37(38)40(6,7)8/h9-11,13-25H,12,26H2,1-8H3 |
| InChIKey | AUHASMNQOANZFR-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|