C44H48 — CID 140517693
2,7-ditert-butyl-1-[(3-pent-4-enylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]-9H-fluorene (PubChem CID 140517693) has the molecular formula C44H48 and a molecular weight of 576.87 g/mol. Its IUPAC name is 2,7-ditert-butyl-1-[(3-pent-4-enylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]-9H-fluorene.
| Compound Name | 2,7-ditert-butyl-1-[(3-pent-4-enylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]-9H-fluorene |
|---|---|
| PubChem CID | 140517693 |
| Molecular Formula | C44H48 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 2,7-ditert-butyl-1-[(3-pent-4-enylcyclopenta-1,3-dien-1-yl)-diphenylmethyl]-9H-fluorene |
| SMILES | C=CCCCC1=CCC(C(c2ccccc2)(c2ccccc2)c2c(C(C)(C)C)ccc3c2Cc2cc(C(C)(C)C)ccc2-3)=C1 |
| InChI | InChI=1S/C44H48/c1-8-9-12-17-31-22-23-36(28-31)44(33-18-13-10-14-19-33,34-20-15-11-16-21-34)41-39-30-32-29-35(42(2,3)4)24-25-37(32)38(39)26-27-40(41)43(5,6)7/h8,10-11,13-16,18-22,24-29H,1,9,12,17,23,30H2,2-7H3 |
| InChIKey | ZGUYXRIHHZMMAD-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|