C43H50N2 — CID 140870415
4-[cyclopenta-2,4-dien-1-yl-(3,6-ditert-butyl-9H-fluoren-1-yl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline (PubChem CID 140870415) has the molecular formula C43H50N2 and a molecular weight of 594.89 g/mol. Its IUPAC name is 4-[cyclopenta-2,4-dien-1-yl-(3,6-ditert-butyl-9H-fluoren-1-yl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[cyclopenta-2,4-dien-1-yl-(3,6-ditert-butyl-9H-fluoren-1-yl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 140870415 |
| Molecular Formula | C43H50N2 |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | 4-[cyclopenta-2,4-dien-1-yl-(3,6-ditert-butyl-9H-fluoren-1-yl)-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)(c2cc(C(C)(C)C)cc3c2Cc2ccc(C(C)(C)C)cc2-3)C2C=CC=C2)cc1 |
| InChI | InChI=1S/C43H50N2/c1-41(2,3)33-16-15-29-25-39-38(37(29)26-33)27-34(42(4,5)6)28-40(39)43(30-13-11-12-14-30,31-17-21-35(22-18-31)44(7)8)32-19-23-36(24-20-32)45(9)10/h11-24,26-28,30H,25H2,1-10H3 |
| InChIKey | TXMPNXLGJHSVMO-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|