C49H56 — CID 102246847
3,12,20,29-tetratert-butyloctacyclo[23.8.0.04,32.07,31.010,15.014,18.017,22.028,33]tritriaconta-1(25),2,4(32),5,7(31),10(15),11,13,17(22),18,20,26,28(33),29-tetradecaene (PubChem CID 102246847) has the molecular formula C49H56 and a molecular weight of 644.99 g/mol. Its IUPAC name is 3,12,20,29-tetratert-butyloctacyclo[23.8.0.04,32.07,31.010,15.014,18.017,22.028,33]tritriaconta-1(25),2,4(32),5,7(31),10(15),11,13,17(22),18,20,26,28(33),29-tetradecaene.
| Compound Name | 3,12,20,29-tetratert-butyloctacyclo[23.8.0.04,32.07,31.010,15.014,18.017,22.028,33]tritriaconta-1(25),2,4(32),5,7(31),10(15),11,13,17(22),18,20,26,28(33),29-tetradecaene |
|---|---|
| PubChem CID | 102246847 |
| Molecular Formula | C49H56 |
| Molecular Weight | 644.99 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | 3,12,20,29-tetratert-butyloctacyclo[23.8.0.04,32.07,31.010,15.014,18.017,22.028,33]tritriaconta-1(25),2,4(32),5,7(31),10(15),11,13,17(22),18,20,26,28(33),29-tetradecaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)-c1cc(C(C)(C)C)cc(c1C3)CCc1ccc3c(C(C)(C)C)cc4c(ccc5c(C(C)(C)C)cc1c3c45)CC2 |
| InChI | InChI=1S/C49H56/c1-46(2,3)32-21-30-15-13-28-17-19-34-43(49(10,11)12)27-39-29(18-20-35-42(48(7,8)9)26-38(28)44(34)45(35)39)14-16-31-22-33(47(4,5)6)24-41-37(31)25-36(30)40(41)23-32/h17-24,26-27H,13-16,25H2,1-12H3 |
| InChIKey | KRELUHDKHFLZOH-UHFFFAOYSA-N |
| XLogP | 13.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.99 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|