C23H34N2O2Si — CID 139803095
1-[tert-butyl(dimethoxy)silyl]-2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine (PubChem CID 139803095) has the molecular formula C23H34N2O2Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 1-[tert-butyl(dimethoxy)silyl]-2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine.
| Compound Name | 1-[tert-butyl(dimethoxy)silyl]-2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine |
|---|---|
| PubChem CID | 139803095 |
| Molecular Formula | C23H34N2O2Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[tert-butyl(dimethoxy)silyl]-2-N,2-N,7-N,7-N-tetramethyl-9H-fluorene-2,7-diamine |
| SMILES | CO[Si](OC)(c1c(N(C)C)ccc2c1Cc1cc(N(C)C)ccc1-2)C(C)(C)C |
| InChI | InChI=1S/C23H34N2O2Si/c1-23(2,3)28(26-8,27-9)22-20-15-16-14-17(24(4)5)10-11-18(16)19(20)12-13-21(22)25(6)7/h10-14H,15H2,1-9H3 |
| InChIKey | VGXCLMLHSYQCPT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|