C10H18N2O4S — CID 174351505
propanoic acid;thiophene-2,3-diamine (PubChem CID 174351505) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is propanoic acid;thiophene-2,3-diamine.
| Compound Name | propanoic acid;thiophene-2,3-diamine |
|---|---|
| PubChem CID | 174351505 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | propanoic acid;thiophene-2,3-diamine |
| SMILES | CCC(=O)O.CCC(=O)O.Nc1ccsc1N |
| InChI | InChI=1S/C4H6N2S.2C3H6O2/c5-3-1-2-7-4(3)6;2*1-2-3(4)5/h1-2H,5-6H2;2*2H2,1H3,(H,4,5) |
| InChIKey | AVQZODCPQZJQJB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |