C17H17N3O4S — CID 17435513
4-[(4Z)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-1,3-oxazol-2-yl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 17435513) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[(4Z)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-1,3-oxazol-2-yl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[(4Z)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-1,3-oxazol-2-yl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 17435513 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-[(4Z)-5-oxo-4-(1H-pyrrol-2-ylmethylidene)-1,3-oxazol-2-yl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C2=N/C(=C\c3ccc[nH]3)C(=O)O2)cc1 |
| InChI | InChI=1S/C17H17N3O4S/c1-11(2)20-25(22,23)14-7-5-12(6-8-14)16-19-15(17(21)24-16)10-13-4-3-9-18-13/h3-11,18,20H,1-2H3/b15-10- |
| InChIKey | YOQMDFCDGIHFRT-GDNBJRDFSA-N |
| XLogP | 2.05 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|