About 1-chloro-2-fluorobenzene;propan-2-one
1-chloro-2-fluorobenzene;propan-2-one (PubChem CID 174355607) has the molecular formula C9H10ClFO
and a molecular weight of 188.63 g/mol. Its IUPAC name is 1-chloro-2-fluorobenzene;propan-2-one.
Molecular Properties
| Compound Name | 1-chloro-2-fluorobenzene;propan-2-one |
| PubChem CID | 174355607 |
| Molecular Formula | C9H10ClFO |
| Molecular Weight | 188.63 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1-chloro-2-fluorobenzene;propan-2-one |
| SMILES | CC(C)=O.Fc1ccccc1Cl |
| InChI | InChI=1S/C6H4ClF.C3H6O/c7-5-3-1-2-4-6(5)8;1-3(2)4/h1-4H;1-2H3 |
| InChIKey | RAYDRTGSGQAZMK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-2-fluorobenzene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-fluorobenzene;propan-2-one?
The IUPAC name of 1-chloro-2-fluorobenzene;propan-2-one (CID 174355607) is 1-chloro-2-fluorobenzene;propan-2-one.
What is the SMILES notation for 1-chloro-2-fluorobenzene;propan-2-one?
The canonical SMILES for 1-chloro-2-fluorobenzene;propan-2-one is CC(C)=O.Fc1ccccc1Cl.
What is the InChIKey of 1-chloro-2-fluorobenzene;propan-2-one?
The InChIKey is RAYDRTGSGQAZMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClF.C3H6O/c7-5-3-1-2-4-6(5)8;1-3(2)4/h1-4H;1-2H3.
What are the key properties of 1-chloro-2-fluorobenzene;propan-2-one?
1-chloro-2-fluorobenzene;propan-2-one has a molecular weight of 188.63 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-fluorobenzene;propan-2-one is sourced from PubChem (CID 174355607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).