C17H18BrN3 — CID 174356029
3-[(1-ethyl-2H-pyridin-3-yl)methyl]-1H-indole-5-carbonitrile;hydrobromide (PubChem CID 174356029) has the molecular formula C17H18BrN3 and a molecular weight of 344.26 g/mol. Its IUPAC name is 3-[(1-ethyl-2H-pyridin-3-yl)methyl]-1H-indole-5-carbonitrile;hydrobromide.
| Compound Name | 3-[(1-ethyl-2H-pyridin-3-yl)methyl]-1H-indole-5-carbonitrile;hydrobromide |
|---|---|
| PubChem CID | 174356029 |
| Molecular Formula | C17H18BrN3 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-[(1-ethyl-2H-pyridin-3-yl)methyl]-1H-indole-5-carbonitrile;hydrobromide |
| SMILES | Br.CCN1C=CC=C(Cc2c[nH]c3ccc(C#N)cc23)C1 |
| InChI | InChI=1S/C17H17N3.BrH/c1-2-20-7-3-4-14(12-20)8-15-11-19-17-6-5-13(10-18)9-16(15)17;/h3-7,9,11,19H,2,8,12H2,1H3;1H |
| InChIKey | QVCWJAZMJYZBDX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |