C21H30N4O3S — CID 174362374
4-[8-[4-(methylamino)piperidin-1-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-3-methylsulfanylazepane-2,7-dione (PubChem CID 174362374) has the molecular formula C21H30N4O3S and a molecular weight of 418.56 g/mol. Its IUPAC name is 4-[8-[4-(methylamino)piperidin-1-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-3-methylsulfanylazepane-2,7-dione.
| Compound Name | 4-[8-[4-(methylamino)piperidin-1-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-3-methylsulfanylazepane-2,7-dione |
|---|---|
| PubChem CID | 174362374 |
| Molecular Formula | C21H30N4O3S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 4-[8-[4-(methylamino)piperidin-1-yl]-2,3-dihydro-1,4-benzoxazin-4-yl]-3-methylsulfanylazepane-2,7-dione |
| SMILES | CNC1CCN(c2cccc3c2OCCN3C2CCC(=O)NC(=O)C2SC)CC1 |
| InChI | InChI=1S/C21H30N4O3S/c1-22-14-8-10-24(11-9-14)15-4-3-5-16-19(15)28-13-12-25(16)17-6-7-18(26)23-21(27)20(17)29-2/h3-5,14,17,20,22H,6-13H2,1-2H3,(H,23,26,27) |
| InChIKey | QOHVREMOSSXWED-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|