C18H22FN3O3 — CID 170449923
3-(7-fluoro-8-piperidin-4-yl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione (PubChem CID 170449923) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 3-(7-fluoro-8-piperidin-4-yl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-fluoro-8-piperidin-4-yl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170449923 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-(7-fluoro-8-piperidin-4-yl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CCOc3c2ccc(F)c3C2CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C18H22FN3O3/c19-12-1-2-13-17(16(12)11-5-7-20-8-6-11)25-10-9-22(13)14-3-4-15(23)21-18(14)24/h1-2,11,14,20H,3-10H2,(H,21,23,24) |
| InChIKey | CWXWYLGFIBPLDB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|