C18H22N2O3 — CID 170614887
3-(7-cyclopentyl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione (PubChem CID 170614887) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-(7-cyclopentyl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-cyclopentyl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170614887 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-(7-cyclopentyl-2,3-dihydro-1,4-benzoxazin-4-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CCOc3cc(C4CCCC4)ccc32)C(=O)N1 |
| InChI | InChI=1S/C18H22N2O3/c21-17-8-7-15(18(22)19-17)20-9-10-23-16-11-13(5-6-14(16)20)12-3-1-2-4-12/h5-6,11-12,15H,1-4,7-10H2,(H,19,21,22) |
| InChIKey | VLTYACOJBNCFBT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|