C19H22N4O6 — CID 177116091
2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-oxo-1,4-benzoxazin-8-yl]piperazin-1-yl]acetic acid (PubChem CID 177116091) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is 2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-oxo-1,4-benzoxazin-8-yl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-oxo-1,4-benzoxazin-8-yl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 177116091 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[4-[4-(2,6-dioxopiperidin-3-yl)-3-oxo-1,4-benzoxazin-8-yl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(c2cccc3c2OCC(=O)N3C2CCC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C19H22N4O6/c24-15-5-4-14(19(28)20-15)23-13-3-1-2-12(18(13)29-11-16(23)25)22-8-6-21(7-9-22)10-17(26)27/h1-3,14H,4-11H2,(H,26,27)(H,20,24,28) |
| InChIKey | QRQOWXOJTSZVQH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|