C19H16N2O4 — CID 170614983
3-(3-oxo-8-phenyl-1,4-benzoxazin-4-yl)piperidine-2,6-dione (PubChem CID 170614983) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-(3-oxo-8-phenyl-1,4-benzoxazin-4-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-oxo-8-phenyl-1,4-benzoxazin-4-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170614983 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-(3-oxo-8-phenyl-1,4-benzoxazin-4-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)COc3c(-c4ccccc4)cccc32)C(=O)N1 |
| InChI | InChI=1S/C19H16N2O4/c22-16-10-9-15(19(24)20-16)21-14-8-4-7-13(12-5-2-1-3-6-12)18(14)25-11-17(21)23/h1-8,15H,9-11H2,(H,20,22,24) |
| InChIKey | QDOUGNVQICMASR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|