C25H28IN3O4 — CID 174363693
methyl 4-[2-butyl-4-iodo-5-[(2-methoxycarbonylanilino)methyl]imidazol-1-yl]-3-methylbenzoate (PubChem CID 174363693) has the molecular formula C25H28IN3O4 and a molecular weight of 561.42 g/mol. Its IUPAC name is methyl 4-[2-butyl-4-iodo-5-[(2-methoxycarbonylanilino)methyl]imidazol-1-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[2-butyl-4-iodo-5-[(2-methoxycarbonylanilino)methyl]imidazol-1-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 174363693 |
| Molecular Formula | C25H28IN3O4 |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | methyl 4-[2-butyl-4-iodo-5-[(2-methoxycarbonylanilino)methyl]imidazol-1-yl]-3-methylbenzoate |
| SMILES | CCCCc1nc(I)c(CNc2ccccc2C(=O)OC)n1-c1ccc(C(=O)OC)cc1C |
| InChI | InChI=1S/C25H28IN3O4/c1-5-6-11-22-28-23(26)21(15-27-19-10-8-7-9-18(19)25(31)33-4)29(22)20-13-12-17(14-16(20)2)24(30)32-3/h7-10,12-14,27H,5-6,11,15H2,1-4H3 |
| InChIKey | MKMZCTNMVPDTGR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|