C10H12N2O7S — CID 174364527
methyl 4-(methoxycarbonyloxyamino)-2-sulfamoylbenzoate (PubChem CID 174364527) has the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. Its IUPAC name is methyl 4-(methoxycarbonyloxyamino)-2-sulfamoylbenzoate.
| Compound Name | methyl 4-(methoxycarbonyloxyamino)-2-sulfamoylbenzoate |
|---|---|
| PubChem CID | 174364527 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | methyl 4-(methoxycarbonyloxyamino)-2-sulfamoylbenzoate |
| SMILES | COC(=O)ONc1ccc(C(=O)OC)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H12N2O7S/c1-17-9(13)7-4-3-6(12-19-10(14)18-2)5-8(7)20(11,15)16/h3-5,12H,1-2H3,(H2,11,15,16) |
| InChIKey | UQMKRDMLRITMIU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|