C10H10F3N3O4S — CID 67792091
methyl 2-sulfamoyl-4-[2-(2,2,2-trifluoroethylidene)hydrazinyl]benzoate (PubChem CID 67792091) has the molecular formula C10H10F3N3O4S and a molecular weight of 325.27 g/mol. Its IUPAC name is methyl 2-sulfamoyl-4-[2-(2,2,2-trifluoroethylidene)hydrazinyl]benzoate.
| Compound Name | methyl 2-sulfamoyl-4-[2-(2,2,2-trifluoroethylidene)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 67792091 |
| Molecular Formula | C10H10F3N3O4S |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | methyl 2-sulfamoyl-4-[2-(2,2,2-trifluoroethylidene)hydrazinyl]benzoate |
| SMILES | COC(=O)c1ccc(NN=CC(F)(F)F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10F3N3O4S/c1-20-9(17)7-3-2-6(4-8(7)21(14,18)19)16-15-5-10(11,12)13/h2-5,16H,1H3,(H2,14,18,19) |
| InChIKey | ZACWQVGWWLEIII-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|