C12H9NO4S2 — CID 174366558
[6-(furan-2-yl)-4-hydroxy-2H-thieno[2,3-e]thiazin-3-yl] acetate (PubChem CID 174366558) has the molecular formula C12H9NO4S2 and a molecular weight of 295.34 g/mol. Its IUPAC name is [6-(furan-2-yl)-4-hydroxy-2H-thieno[2,3-e]thiazin-3-yl] acetate.
| Compound Name | [6-(furan-2-yl)-4-hydroxy-2H-thieno[2,3-e]thiazin-3-yl] acetate |
|---|---|
| PubChem CID | 174366558 |
| Molecular Formula | C12H9NO4S2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | [6-(furan-2-yl)-4-hydroxy-2H-thieno[2,3-e]thiazin-3-yl] acetate |
| SMILES | CC(=O)OC1=C(O)c2sc(-c3ccco3)cc2SN1 |
| InChI | InChI=1S/C12H9NO4S2/c1-6(14)17-12-10(15)11-9(19-13-12)5-8(18-11)7-3-2-4-16-7/h2-5,13,15H,1H3 |
| InChIKey | XZLMKBFOXPQGKB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|