C26H27ClN2O2 — CID 174373312
[2-[3-chloro-4-(2-methylphenyl)anilino]phenyl]-cyclohexylcarbamic acid (PubChem CID 174373312) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is [2-[3-chloro-4-(2-methylphenyl)anilino]phenyl]-cyclohexylcarbamic acid.
| Compound Name | [2-[3-chloro-4-(2-methylphenyl)anilino]phenyl]-cyclohexylcarbamic acid |
|---|---|
| PubChem CID | 174373312 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [2-[3-chloro-4-(2-methylphenyl)anilino]phenyl]-cyclohexylcarbamic acid |
| SMILES | Cc1ccccc1-c1ccc(Nc2ccccc2N(C(=O)O)C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C26H27ClN2O2/c1-18-9-5-6-12-21(18)22-16-15-19(17-23(22)27)28-24-13-7-8-14-25(24)29(26(30)31)20-10-3-2-4-11-20/h5-9,12-17,20,28H,2-4,10-11H2,1H3,(H,30,31) |
| InChIKey | XDICHLMKUYXFGQ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |