C17H24N4O2 — CID 174374740
3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-oxadiazole;pyridine (PubChem CID 174374740) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-oxadiazole;pyridine.
| Compound Name | 3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-oxadiazole;pyridine |
|---|---|
| PubChem CID | 174374740 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-butoxy-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-oxadiazole;pyridine |
| SMILES | CCCCOc1nonc1C1=CCCN(C)C1.c1ccncc1 |
| InChI | InChI=1S/C12H19N3O2.C5H5N/c1-3-4-8-16-12-11(13-17-14-12)10-6-5-7-15(2)9-10;1-2-4-6-5-3-1/h6H,3-5,7-9H2,1-2H3;1-5H |
| InChIKey | BESPFMHFBYSHNC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|