H9B4O18P3 — CID 174376463
[boronooxy-[boronooxy-[boronooxy(hydroxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyboronic acid (PubChem CID 174376463) has the molecular formula H9B4O18P3 and a molecular weight of 433.22 g/mol. Its IUPAC name is [boronooxy-[boronooxy-[boronooxy(hydroxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyboronic acid.
| Compound Name | [boronooxy-[boronooxy-[boronooxy(hydroxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyboronic acid |
|---|---|
| PubChem CID | 174376463 |
| Molecular Formula | H9B4O18P3 |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | [boronooxy-[boronooxy-[boronooxy(hydroxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyboronic acid |
| SMILES | O=P(O)(OB(O)O)OP(=O)(OB(O)O)OP(=O)(OB(O)O)OB(O)O |
| InChI | InChI=1S/B4H9O18P3/c5-1(6)17-23(13,14)21-25(16,20-4(11)12)22-24(15,18-2(7)8)19-3(9)10/h5-12H,(H,13,14) |
| InChIKey | HDZXJNVXSJNYNE-UHFFFAOYSA-N |
| XLogP | -4.72 |
| TPSA | 288.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|