C17H26N4O2 — CID 174377153
tert-butyl 2,2,4-tris(methylamino)quinoline-1-carboxylate (PubChem CID 174377153) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl 2,2,4-tris(methylamino)quinoline-1-carboxylate.
| Compound Name | tert-butyl 2,2,4-tris(methylamino)quinoline-1-carboxylate |
|---|---|
| PubChem CID | 174377153 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | tert-butyl 2,2,4-tris(methylamino)quinoline-1-carboxylate |
| SMILES | CNC1=CC(NC)(NC)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H26N4O2/c1-16(2,3)23-15(22)21-14-10-8-7-9-12(14)13(18-4)11-17(21,19-5)20-6/h7-11,18-20H,1-6H3 |
| InChIKey | ZEOZNHWSPGBCNL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|