C15H19NO4 — CID 10356140
tert-butyl 2-hydroperoxy-2-methyl-3-methylideneindole-1-carboxylate (PubChem CID 10356140) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is tert-butyl 2-hydroperoxy-2-methyl-3-methylideneindole-1-carboxylate.
| Compound Name | tert-butyl 2-hydroperoxy-2-methyl-3-methylideneindole-1-carboxylate |
|---|---|
| PubChem CID | 10356140 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | tert-butyl 2-hydroperoxy-2-methyl-3-methylideneindole-1-carboxylate |
| SMILES | C=C1c2ccccc2N(C(=O)OC(C)(C)C)C1(C)OO |
| InChI | InChI=1S/C15H19NO4/c1-10-11-8-6-7-9-12(11)16(15(10,5)20-18)13(17)19-14(2,3)4/h6-9,18H,1H2,2-5H3 |
| InChIKey | SAPUUSMJIHAHGN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|