C25H34N2O4S — CID 174377362
(4-butanimidoylphenyl) 4-[benzyl(butylsulfonyl)amino]butanoate (PubChem CID 174377362) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is (4-butanimidoylphenyl) 4-[benzyl(butylsulfonyl)amino]butanoate.
| Compound Name | (4-butanimidoylphenyl) 4-[benzyl(butylsulfonyl)amino]butanoate |
|---|---|
| PubChem CID | 174377362 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (4-butanimidoylphenyl) 4-[benzyl(butylsulfonyl)amino]butanoate |
| SMILES | [H]/N=C(\CCC)c1ccc(OC(=O)CCCN(Cc2ccccc2)S(=O)(=O)CCCC)cc1 |
| InChI | InChI=1S/C25H34N2O4S/c1-3-5-19-32(29,30)27(20-21-11-7-6-8-12-21)18-9-13-25(28)31-23-16-14-22(15-17-23)24(26)10-4-2/h6-8,11-12,14-17,26H,3-5,9-10,13,18-20H2,1-2H3/b26-24+ |
| InChIKey | JVYHFIPPHCLZFE-SHHOIMCASA-N |
| XLogP | 5.17 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|