C19H26N2O8S2 — CID 174390217
2-[[[4-(4-butanimidoylphenoxy)-4-oxobutyl]-sulfinoamino]methyl]-2-methylsulfanylpropanedioic acid (PubChem CID 174390217) has the molecular formula C19H26N2O8S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[[[4-(4-butanimidoylphenoxy)-4-oxobutyl]-sulfinoamino]methyl]-2-methylsulfanylpropanedioic acid.
| Compound Name | 2-[[[4-(4-butanimidoylphenoxy)-4-oxobutyl]-sulfinoamino]methyl]-2-methylsulfanylpropanedioic acid |
|---|---|
| PubChem CID | 174390217 |
| Molecular Formula | C19H26N2O8S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-[[[4-(4-butanimidoylphenoxy)-4-oxobutyl]-sulfinoamino]methyl]-2-methylsulfanylpropanedioic acid |
| SMILES | [H]/N=C(\CCC)c1ccc(OC(=O)CCCN(CC(SC)(C(=O)O)C(=O)O)S(=O)O)cc1 |
| InChI | InChI=1S/C19H26N2O8S2/c1-3-5-15(20)13-7-9-14(10-8-13)29-16(22)6-4-11-21(31(27)28)12-19(30-2,17(23)24)18(25)26/h7-10,20H,3-6,11-12H2,1-2H3,(H,23,24)(H,25,26)(H,27,28)/b20-15+ |
| InChIKey | BDCRDTXTXBFTHQ-HMMYKYKNSA-N |
| XLogP | 2.25 |
| TPSA | 165.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|