About (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate
(4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate (PubChem CID 174435960) has the molecular formula C24H30N2O3
and a molecular weight of 394.52 g/mol. Its IUPAC name is (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate.
Molecular Properties
| Compound Name | (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate |
| PubChem CID | 174435960 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate |
| SMILES | [H]/N=C(\CCC)c1ccc(OC(=O)CCCc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-2-4-23(25)20-9-13-22(14-10-20)29-24(27)6-3-5-19-7-11-21(12-8-19)26-15-17-28-18-16-26/h7-14,25H,2-6,15-18H2,1H3/b25-23+ |
| InChIKey | FXJLNSCNRGHBDU-WJTDDFOZSA-N |
| XLogP | 4.62 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate?
The IUPAC name of (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate (CID 174435960) is (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate.
What is the SMILES notation for (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate?
The canonical SMILES for (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate is [H]/N=C(\CCC)c1ccc(OC(=O)CCCc2ccc(N3CCOCC3)cc2)cc1.
What is the InChIKey of (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate?
The InChIKey is FXJLNSCNRGHBDU-WJTDDFOZSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-2-4-23(25)20-9-13-22(14-10-20)29-24(27)6-3-5-19-7-11-21(12-8-19)26-15-17-28-18-16-26/h7-14,25H,2-6,15-18H2,1H3/b25-23+.
What are the key properties of (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate?
(4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate has a molecular weight of 394.52 g/mol, XLogP of 4.62, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butanimidoylphenyl) 4-(4-morpholin-4-ylphenyl)butanoate is sourced from PubChem (CID 174435960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).