C27H28N6O4S — CID 174377371
(4-butanimidoylphenyl) 4-phenyl-4-[[2-(5H-tetrazol-5-yl)phenyl]sulfamoyl]butanoate (PubChem CID 174377371) has the molecular formula C27H28N6O4S and a molecular weight of 532.63 g/mol. Its IUPAC name is (4-butanimidoylphenyl) 4-phenyl-4-[[2-(5H-tetrazol-5-yl)phenyl]sulfamoyl]butanoate.
| Compound Name | (4-butanimidoylphenyl) 4-phenyl-4-[[2-(5H-tetrazol-5-yl)phenyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 174377371 |
| Molecular Formula | C27H28N6O4S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (4-butanimidoylphenyl) 4-phenyl-4-[[2-(5H-tetrazol-5-yl)phenyl]sulfamoyl]butanoate |
| SMILES | [H]/N=C(\CCC)c1ccc(OC(=O)CCC(c2ccccc2)S(=O)(=O)Nc2ccccc2C2N=NN=N2)cc1 |
| InChI | InChI=1S/C27H28N6O4S/c1-2-8-23(28)19-13-15-21(16-14-19)37-26(34)18-17-25(20-9-4-3-5-10-20)38(35,36)31-24-12-7-6-11-22(24)27-29-32-33-30-27/h3-7,9-16,25,27-28,31H,2,8,17-18H2,1H3/b28-23+ |
| InChIKey | ZLEHXDDQIBBKAO-WEMUOSSPSA-N |
| XLogP | 6.55 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|