C27H31N3O4S — CID 174377577
[2-(aminomethyl)-4-(phenylsulfamoyl)phenyl] 4-(4-butanimidoylphenyl)butanoate (PubChem CID 174377577) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is [2-(aminomethyl)-4-(phenylsulfamoyl)phenyl] 4-(4-butanimidoylphenyl)butanoate.
| Compound Name | [2-(aminomethyl)-4-(phenylsulfamoyl)phenyl] 4-(4-butanimidoylphenyl)butanoate |
|---|---|
| PubChem CID | 174377577 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | [2-(aminomethyl)-4-(phenylsulfamoyl)phenyl] 4-(4-butanimidoylphenyl)butanoate |
| SMILES | [H]/N=C(\CCC)c1ccc(CCCC(=O)Oc2ccc(S(=O)(=O)Nc3ccccc3)cc2CN)cc1 |
| InChI | InChI=1S/C27H31N3O4S/c1-2-7-25(29)21-14-12-20(13-15-21)8-6-11-27(31)34-26-17-16-24(18-22(26)19-28)35(32,33)30-23-9-4-3-5-10-23/h3-5,9-10,12-18,29-30H,2,6-8,11,19,28H2,1H3/b29-25+ |
| InChIKey | IEOUMGALOXUPIA-XLVZBRSZSA-N |
| XLogP | 5.04 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|