C25H32N2O6S — CID 174377854
4-[[4-(4-butanimidoylphenoxy)-4-oxo-1-phenylbutyl]sulfamoyl]-3-methylbutanoic acid (PubChem CID 174377854) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[[4-(4-butanimidoylphenoxy)-4-oxo-1-phenylbutyl]sulfamoyl]-3-methylbutanoic acid.
| Compound Name | 4-[[4-(4-butanimidoylphenoxy)-4-oxo-1-phenylbutyl]sulfamoyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 174377854 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-[[4-(4-butanimidoylphenoxy)-4-oxo-1-phenylbutyl]sulfamoyl]-3-methylbutanoic acid |
| SMILES | [H]/N=C(\CCC)c1ccc(OC(=O)CCC(NS(=O)(=O)CC(C)CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H32N2O6S/c1-3-7-22(26)19-10-12-21(13-11-19)33-25(30)15-14-23(20-8-5-4-6-9-20)27-34(31,32)17-18(2)16-24(28)29/h4-6,8-13,18,23,26-27H,3,7,14-17H2,1-2H3,(H,28,29)/b26-22+ |
| InChIKey | NSFTVGAHNJYGBY-XTCLZLMSSA-N |
| XLogP | 4.31 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|