C10H11F3N2O — CID 174378311
2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazinane (PubChem CID 174378311) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazinane.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazinane |
|---|---|
| PubChem CID | 174378311 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazinane |
| SMILES | FC(F)(F)c1cccc(C2NNCCO2)c1 |
| InChI | InChI=1S/C10H11F3N2O/c11-10(12,13)8-3-1-2-7(6-8)9-15-14-4-5-16-9/h1-3,6,9,14-15H,4-5H2 |
| InChIKey | IXYFTRLQSUBODV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |