C16H15Cl2Zr — CID 174379862
2-cyclopenta-1,3-dien-1-yl-3-ethyl-1H-inden-1-ide;zirconium(3+);dichloride (PubChem CID 174379862) has the molecular formula C16H15Cl2Zr and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-3-ethyl-1H-inden-1-ide;zirconium(3+);dichloride.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-3-ethyl-1H-inden-1-ide;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 174379862 |
| Molecular Formula | C16H15Cl2Zr |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-3-ethyl-1H-inden-1-ide;zirconium(3+);dichloride |
| SMILES | CCc1c(C2=CC=CC2)[cH-]c2ccccc12.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C16H15.2ClH.Zr/c1-2-14-15-10-6-5-9-13(15)11-16(14)12-7-3-4-8-12;;;/h3-7,9-11H,2,8H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | PLPFZPUOZBVHPC-UHFFFAOYSA-L |
| XLogP | -1.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|