C39H51N5O4 — CID 174382277
1-[1-butyl-2-oxo-4-[3-(3-piperidin-3-ylpropoxy)phenyl]-1,8-naphthyridin-3-yl]-1-[4-hydroxy-2,6-di(propan-2-yl)phenyl]urea (PubChem CID 174382277) has the molecular formula C39H51N5O4 and a molecular weight of 653.87 g/mol. Its IUPAC name is 1-[1-butyl-2-oxo-4-[3-(3-piperidin-3-ylpropoxy)phenyl]-1,8-naphthyridin-3-yl]-1-[4-hydroxy-2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[1-butyl-2-oxo-4-[3-(3-piperidin-3-ylpropoxy)phenyl]-1,8-naphthyridin-3-yl]-1-[4-hydroxy-2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 174382277 |
| Molecular Formula | C39H51N5O4 |
| Molecular Weight | 653.87 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | 1-[1-butyl-2-oxo-4-[3-(3-piperidin-3-ylpropoxy)phenyl]-1,8-naphthyridin-3-yl]-1-[4-hydroxy-2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCn1c(=O)c(N(C(N)=O)c2c(C(C)C)cc(O)cc2C(C)C)c(-c2cccc(OCCCC3CCCNC3)c2)c2cccnc21 |
| InChI | InChI=1S/C39H51N5O4/c1-6-7-19-43-37-31(16-10-18-42-37)34(28-14-8-15-30(21-28)48-20-11-13-27-12-9-17-41-24-27)36(38(43)46)44(39(40)47)35-32(25(2)3)22-29(45)23-33(35)26(4)5/h8,10,14-16,18,21-23,25-27,41,45H,6-7,9,11-13,17,19-20,24H2,1-5H3,(H2,40,47) |
| InChIKey | JPIJAQNSXREOIL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.87 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|