C13H18O — CID 174387140
3-cyclopropyl-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde (PubChem CID 174387140) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-cyclopropyl-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde.
| Compound Name | 3-cyclopropyl-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 174387140 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 3-cyclopropyl-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
| SMILES | C=C1CC(C)(C)C(C2CC2)=CC1C=O |
| InChI | InChI=1S/C13H18O/c1-9-7-13(2,3)12(10-4-5-10)6-11(9)8-14/h6,8,10-11H,1,4-5,7H2,2-3H3 |
| InChIKey | GKIFAMJIHBGEOB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|