C11H14O3 — CID 174386871
(6-formyl-3,3-dimethyl-5-methylidenecyclohexen-1-yl) formate (PubChem CID 174386871) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (6-formyl-3,3-dimethyl-5-methylidenecyclohexen-1-yl) formate.
| Compound Name | (6-formyl-3,3-dimethyl-5-methylidenecyclohexen-1-yl) formate |
|---|---|
| PubChem CID | 174386871 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (6-formyl-3,3-dimethyl-5-methylidenecyclohexen-1-yl) formate |
| SMILES | C=C1CC(C)(C)C=C(OC=O)C1C=O |
| InChI | InChI=1S/C11H14O3/c1-8-4-11(2,3)5-10(14-7-13)9(8)6-12/h5-7,9H,1,4H2,2-3H3 |
| InChIKey | NNIGIJAVIPGBTM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|