C12H19NO — CID 174431342
3-(2-aminoethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde (PubChem CID 174431342) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde.
| Compound Name | 3-(2-aminoethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 174431342 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(2-aminoethyl)-4,4-dimethyl-6-methylidenecyclohex-2-ene-1-carbaldehyde |
| SMILES | C=C1CC(C)(C)C(CCN)=CC1C=O |
| InChI | InChI=1S/C12H19NO/c1-9-7-12(2,3)11(4-5-13)6-10(9)8-14/h6,8,10H,1,4-5,7,13H2,2-3H3 |
| InChIKey | HWZBXWBNPIJKMD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|